C16H15ClF3N5O — CID 133272731
N-[3-(4-chloro-2-methylphenoxy)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133272731) has the molecular formula C16H15ClF3N5O and a molecular weight of 385.78 g/mol. Its IUPAC name is N-[3-(4-chloro-2-methylphenoxy)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[3-(4-chloro-2-methylphenoxy)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133272731 |
| Molecular Formula | C16H15ClF3N5O |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-[3-(4-chloro-2-methylphenoxy)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | Cc1cc(Cl)ccc1OCCCNc1ccc2nnc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C16H15ClF3N5O/c1-10-9-11(17)3-4-12(10)26-8-2-7-21-13-5-6-14-22-23-15(16(18,19)20)25(14)24-13/h3-6,9H,2,7-8H2,1H3,(H,21,24) |
| InChIKey | MEVNUDDKZOONQU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|