C15H13F4N5 — CID 133295888
N-[3-(3-fluorophenyl)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133295888) has the molecular formula C15H13F4N5 and a molecular weight of 339.30 g/mol. Its IUPAC name is N-[3-(3-fluorophenyl)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[3-(3-fluorophenyl)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133295888 |
| Molecular Formula | C15H13F4N5 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-[3-(3-fluorophenyl)propyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | Fc1cccc(CCCNc2ccc3nnc(C(F)(F)F)n3n2)c1 |
| InChI | InChI=1S/C15H13F4N5/c16-11-5-1-3-10(9-11)4-2-8-20-12-6-7-13-21-22-14(15(17,18)19)24(13)23-12/h1,3,5-7,9H,2,4,8H2,(H,20,23) |
| InChIKey | ZDCJXSLKPAZJNC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|