C15H16FN3O4 — CID 133314590
N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]-5-nitropyridin-2-amine (PubChem CID 133314590) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133314590 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[1-(2-fluoro-4,5-dimethoxyphenyl)ethyl]-5-nitropyridin-2-amine |
| SMILES | COc1cc(F)c(C(C)Nc2ccc([N+](=O)[O-])cn2)cc1OC |
| InChI | InChI=1S/C15H16FN3O4/c1-9(18-15-5-4-10(8-17-15)19(20)21)11-6-13(22-2)14(23-3)7-12(11)16/h4-9H,1-3H3,(H,17,18) |
| InChIKey | OBEYYBOGXGJSPN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|