C19H25N3O4 — CID 45351788
N-[1-(3,4-dipropoxyphenyl)ethyl]-5-nitropyridin-2-amine (PubChem CID 45351788) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[1-(3,4-dipropoxyphenyl)ethyl]-5-nitropyridin-2-amine.
| Compound Name | N-[1-(3,4-dipropoxyphenyl)ethyl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 45351788 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[1-(3,4-dipropoxyphenyl)ethyl]-5-nitropyridin-2-amine |
| SMILES | CCCOc1ccc(C(C)Nc2ccc([N+](=O)[O-])cn2)cc1OCCC |
| InChI | InChI=1S/C19H25N3O4/c1-4-10-25-17-8-6-15(12-18(17)26-11-5-2)14(3)21-19-9-7-16(13-20-19)22(23)24/h6-9,12-14H,4-5,10-11H2,1-3H3,(H,20,21) |
| InChIKey | GBBRBWCHIPYJRF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|