C14H18Cl2N4 — CID 68708733
4-[5-(aminomethyl)-4-(2,4-dichlorophenyl)imidazol-1-yl]butan-1-amine (PubChem CID 68708733) has the molecular formula C14H18Cl2N4 and a molecular weight of 313.23 g/mol. Its IUPAC name is 4-[5-(aminomethyl)-4-(2,4-dichlorophenyl)imidazol-1-yl]butan-1-amine.
| Compound Name | 4-[5-(aminomethyl)-4-(2,4-dichlorophenyl)imidazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 68708733 |
| Molecular Formula | C14H18Cl2N4 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-[5-(aminomethyl)-4-(2,4-dichlorophenyl)imidazol-1-yl]butan-1-amine |
| SMILES | NCCCCn1cnc(-c2ccc(Cl)cc2Cl)c1CN |
| InChI | InChI=1S/C14H18Cl2N4/c15-10-3-4-11(12(16)7-10)14-13(8-18)20(9-19-14)6-2-1-5-17/h3-4,7,9H,1-2,5-6,8,17-18H2 |
| InChIKey | DOFNTVCRWUKGPG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|