C27H23Cl2N9O2 — CID 142649362
N'-[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)-N'-(2-pyridin-2-ylethyl)ethane-1,2-diamine (PubChem CID 142649362) has the molecular formula C27H23Cl2N9O2 and a molecular weight of 576.45 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)-N'-(2-pyridin-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)-N'-(2-pyridin-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 142649362 |
| Molecular Formula | C27H23Cl2N9O2 |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | N'-[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)-N'-(2-pyridin-2-ylethyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCN(CCc2ccccn2)c2ncc(-c3ncc[nH]3)c(-c3ccc(Cl)cc3Cl)n2)nc1 |
| InChI | InChI=1S/C27H23Cl2N9O2/c28-18-4-6-21(23(29)15-18)25-22(26-32-10-11-33-26)17-35-27(36-25)37(13-8-19-3-1-2-9-30-19)14-12-31-24-7-5-20(16-34-24)38(39)40/h1-7,9-11,15-17H,8,12-14H2,(H,31,34)(H,32,33) |
| InChIKey | WZQCMNDUGJVDKA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|