C21H17Cl2N7O3 — CID 173234265
N-[2-[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]ethyl]-6-methoxy-5-nitropyridin-2-amine (PubChem CID 173234265) has the molecular formula C21H17Cl2N7O3 and a molecular weight of 486.32 g/mol. Its IUPAC name is N-[2-[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]ethyl]-6-methoxy-5-nitropyridin-2-amine.
| Compound Name | N-[2-[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]ethyl]-6-methoxy-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 173234265 |
| Molecular Formula | C21H17Cl2N7O3 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | N-[2-[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]ethyl]-6-methoxy-5-nitropyridin-2-amine |
| SMILES | COc1nc(NCCc2ncc(-c3ncc[nH]3)c(-c3ccc(Cl)cc3Cl)n2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17Cl2N7O3/c1-33-21-16(30(31)32)4-5-17(29-21)24-7-6-18-27-11-14(20-25-8-9-26-20)19(28-18)13-3-2-12(22)10-15(13)23/h2-5,8-11H,6-7H2,1H3,(H,24,29)(H,25,26) |
| InChIKey | UINIZAPOFGAVFO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|