C20H16N6O4 — CID 57240320
4-[2-nitro-3-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]phenyl]benzonitrile (PubChem CID 57240320) has the molecular formula C20H16N6O4 and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-[2-nitro-3-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]phenyl]benzonitrile.
| Compound Name | 4-[2-nitro-3-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]phenyl]benzonitrile |
|---|---|
| PubChem CID | 57240320 |
| Molecular Formula | C20H16N6O4 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-[2-nitro-3-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(NCCNc3ccc([N+](=O)[O-])cn3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16N6O4/c21-12-14-4-6-15(7-5-14)17-2-1-3-18(20(17)26(29)30)22-10-11-23-19-9-8-16(13-24-19)25(27)28/h1-9,13,22H,10-11H2,(H,23,24) |
| InChIKey | YYTUPYLYFSYWOX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|