C18H20N2O3 — CID 133405981
N-[3-(2,5-dimethoxyphenyl)propyl]-1,3-benzoxazol-2-amine (PubChem CID 133405981) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[3-(2,5-dimethoxyphenyl)propyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[3-(2,5-dimethoxyphenyl)propyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 133405981 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[3-(2,5-dimethoxyphenyl)propyl]-1,3-benzoxazol-2-amine |
| SMILES | COc1ccc(OC)c(CCCNc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-21-14-9-10-16(22-2)13(12-14)6-5-11-19-18-20-15-7-3-4-8-17(15)23-18/h3-4,7-10,12H,5-6,11H2,1-2H3,(H,19,20) |
| InChIKey | OMUHITLJCBQOCR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|