C17H11N5O3 — CID 34317581
5-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-phenyl-1,3-oxazole-4-carbonitrile (PubChem CID 34317581) has the molecular formula C17H11N5O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 5-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-phenyl-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-phenyl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 34317581 |
| Molecular Formula | C17H11N5O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 5-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-phenyl-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(-c2ccccc2)oc1N/N=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11N5O3/c18-10-15-17(25-16(20-15)13-6-2-1-3-7-13)21-19-11-12-5-4-8-14(9-12)22(23)24/h1-9,11,21H/b19-11- |
| InChIKey | YIHADSKRRKBYCY-ODLFYWEKSA-N |
| XLogP | 3.57 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|