C19H16N4O2 — CID 35728131
2-ethyl-5-[(2Z)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile (PubChem CID 35728131) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-ethyl-5-[(2Z)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-ethyl-5-[(2Z)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 35728131 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-ethyl-5-[(2Z)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
| SMILES | CCc1nc(C#N)c(N/N=C\c2cccc(Oc3ccccc3)c2)o1 |
| InChI | InChI=1S/C19H16N4O2/c1-2-18-22-17(12-20)19(25-18)23-21-13-14-7-6-10-16(11-14)24-15-8-4-3-5-9-15/h3-11,13,23H,2H2,1H3/b21-13- |
| InChIKey | CYPBEOKNYRJLEU-BKUYFWCQSA-N |
| XLogP | 4.35 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|