C18H13Cl2N3O — CID 3929502
3,5-dichloro-N-[(3-phenoxyphenyl)methylideneamino]pyridin-4-amine (PubChem CID 3929502) has the molecular formula C18H13Cl2N3O and a molecular weight of 358.23 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3-phenoxyphenyl)methylideneamino]pyridin-4-amine.
| Compound Name | 3,5-dichloro-N-[(3-phenoxyphenyl)methylideneamino]pyridin-4-amine |
|---|---|
| PubChem CID | 3929502 |
| Molecular Formula | C18H13Cl2N3O |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3,5-dichloro-N-[(3-phenoxyphenyl)methylideneamino]pyridin-4-amine |
| SMILES | Clc1cncc(Cl)c1NN=Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C18H13Cl2N3O/c19-16-11-21-12-17(20)18(16)23-22-10-13-5-4-8-15(9-13)24-14-6-2-1-3-7-14/h1-12H,(H,21,23) |
| InChIKey | OYXSNGZSVXBPGV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|