C25H19ClN4O4S — CID 89026371
N-(2-chlorophenyl)-5-nitroso-2-[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 89026371) has the molecular formula C25H19ClN4O4S and a molecular weight of 506.97 g/mol. Its IUPAC name is N-(2-chlorophenyl)-5-nitroso-2-[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-5-nitroso-2-[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 89026371 |
| Molecular Formula | C25H19ClN4O4S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | N-(2-chlorophenyl)-5-nitroso-2-[(2E)-2-[(3-phenoxyphenyl)methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | O=Nc1ccc(N/N=C/c2cccc(Oc3ccccc3)c2)c(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C25H19ClN4O4S/c26-22-11-4-5-12-23(22)30-35(32,33)25-16-19(29-31)13-14-24(25)28-27-17-18-7-6-10-21(15-18)34-20-8-2-1-3-9-20/h1-17,28,30H/b27-17+ |
| InChIKey | XOWDRNJGEPGDJO-WPWMEQJKSA-N |
| XLogP | 6.78 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|