C27H19N5O — CID 11711643
N-[(E)-(4-aminophenyl)methylideneamino]-15-phenyl-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine (PubChem CID 11711643) has the molecular formula C27H19N5O and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[(E)-(4-aminophenyl)methylideneamino]-15-phenyl-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine.
| Compound Name | N-[(E)-(4-aminophenyl)methylideneamino]-15-phenyl-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine |
|---|---|
| PubChem CID | 11711643 |
| Molecular Formula | C27H19N5O |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-[(E)-(4-aminophenyl)methylideneamino]-15-phenyl-11-oxa-14,16-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13,15-octaen-13-amine |
| SMILES | Nc1ccc(/C=N/Nc2nc(-c3ccccc3)nc3c2oc2ccc4ccccc4c23)cc1 |
| InChI | InChI=1S/C27H19N5O/c28-20-13-10-17(11-14-20)16-29-32-27-25-24(30-26(31-27)19-7-2-1-3-8-19)23-21-9-5-4-6-18(21)12-15-22(23)33-25/h1-16H,28H2,(H,30,31,32)/b29-16+ |
| InChIKey | ADWXFNRZLXTWGG-MUFRIFMGSA-N |
| XLogP | 6.22 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|