C17H15N4O3S- — CID 7612956
2-[2-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 7612956) has the molecular formula C17H15N4O3S- and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-[2-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7612956 |
| Molecular Formula | C17H15N4O3S- |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[2-[(Z)-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | Cc1sc2ncnc(N/N=C\c3ccccc3OCC(=O)[O-])c2c1C |
| InChI | InChI=1S/C17H16N4O3S/c1-10-11(2)25-17-15(10)16(18-9-19-17)21-20-7-12-5-3-4-6-13(12)24-8-14(22)23/h3-7,9H,8H2,1-2H3,(H,22,23)(H,18,19,21)/p-1/b20-7- |
| InChIKey | ROAHIHOAEMMJSD-SCDVKCJHSA-M |
| XLogP | 1.88 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|