C19H10Cl4N4OS — CID 2745532
N-[(2,6-dichlorophenyl)methylideneamino]-4-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine (PubChem CID 2745532) has the molecular formula C19H10Cl4N4OS and a molecular weight of 484.20 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methylideneamino]-4-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine.
| Compound Name | N-[(2,6-dichlorophenyl)methylideneamino]-4-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2745532 |
| Molecular Formula | C19H10Cl4N4OS |
| Molecular Weight | 484.20 g/mol |
| Exact Mass | 481.93 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methylideneamino]-4-[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2cc(-c3csc(NN=Cc4c(Cl)cccc4Cl)n3)on2)c(Cl)c1 |
| InChI | InChI=1S/C19H10Cl4N4OS/c20-10-4-5-11(15(23)6-10)16-7-18(28-27-16)17-9-29-19(25-17)26-24-8-12-13(21)2-1-3-14(12)22/h1-9H,(H,25,26) |
| InChIKey | QHDVXZFUFSPHQY-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.20 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|