C23H23Cl2N3S — CID 126061876
N-[(E)-1-(4-cyclohexylphenyl)ethylideneamino]-4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine (PubChem CID 126061876) has the molecular formula C23H23Cl2N3S and a molecular weight of 444.43 g/mol. Its IUPAC name is N-[(E)-1-(4-cyclohexylphenyl)ethylideneamino]-4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-1-(4-cyclohexylphenyl)ethylideneamino]-4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 126061876 |
| Molecular Formula | C23H23Cl2N3S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | N-[(E)-1-(4-cyclohexylphenyl)ethylideneamino]-4-(2,4-dichlorophenyl)-1,3-thiazol-2-amine |
| SMILES | C/C(=N\Nc1nc(-c2ccc(Cl)cc2Cl)cs1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H23Cl2N3S/c1-15(16-7-9-18(10-8-16)17-5-3-2-4-6-17)27-28-23-26-22(14-29-23)20-12-11-19(24)13-21(20)25/h7-14,17H,2-6H2,1H3,(H,26,28)/b27-15+ |
| InChIKey | YWVKWJRSPAMHPA-JFLMPSFJSA-N |
| XLogP | 8.00 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|