C19H15Cl2N3S — CID 5027423
4-(2,4-dichlorophenyl)-N-(4-phenylbut-3-en-2-ylideneamino)-1,3-thiazol-2-amine (PubChem CID 5027423) has the molecular formula C19H15Cl2N3S and a molecular weight of 388.32 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-(4-phenylbut-3-en-2-ylideneamino)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-(4-phenylbut-3-en-2-ylideneamino)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 5027423 |
| Molecular Formula | C19H15Cl2N3S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-(4-phenylbut-3-en-2-ylideneamino)-1,3-thiazol-2-amine |
| SMILES | CC(C=Cc1ccccc1)=NNc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C19H15Cl2N3S/c1-13(7-8-14-5-3-2-4-6-14)23-24-19-22-18(12-25-19)16-10-9-15(20)11-17(16)21/h2-12H,1H3,(H,22,24) |
| InChIKey | QARLHZOBZXXGCM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|