C26H22BrN3O2S2 — CID 170382464
4-[4-(4-bromophenyl)sulfonylphenyl]-N-[(E)-1-(2,3-dihydro-1H-inden-5-yl)ethylideneamino]-1,3-thiazol-2-amine (PubChem CID 170382464) has the molecular formula C26H22BrN3O2S2 and a molecular weight of 552.52 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)sulfonylphenyl]-N-[(E)-1-(2,3-dihydro-1H-inden-5-yl)ethylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(4-bromophenyl)sulfonylphenyl]-N-[(E)-1-(2,3-dihydro-1H-inden-5-yl)ethylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 170382464 |
| Molecular Formula | C26H22BrN3O2S2 |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | 4-[4-(4-bromophenyl)sulfonylphenyl]-N-[(E)-1-(2,3-dihydro-1H-inden-5-yl)ethylideneamino]-1,3-thiazol-2-amine |
| SMILES | C/C(=N\Nc1nc(-c2ccc(S(=O)(=O)c3ccc(Br)cc3)cc2)cs1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C26H22BrN3O2S2/c1-17(20-6-5-18-3-2-4-21(18)15-20)29-30-26-28-25(16-33-26)19-7-11-23(12-8-19)34(31,32)24-13-9-22(27)10-14-24/h5-16H,2-4H2,1H3,(H,28,30)/b29-17+ |
| InChIKey | GKEYWRYEXAVXBH-STBIYBPSSA-N |
| XLogP | 6.73 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|