C20H22ClN3OS — CID 163907531
4-[4-(butylamino)phenyl]-N-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 163907531) has the molecular formula C20H22ClN3OS and a molecular weight of 387.94 g/mol. Its IUPAC name is 4-[4-(butylamino)phenyl]-N-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(butylamino)phenyl]-N-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 163907531 |
| Molecular Formula | C20H22ClN3OS |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-[4-(butylamino)phenyl]-N-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCCNc1ccc(-c2csc(Nc3ccc(OC)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C20H22ClN3OS/c1-3-4-11-22-15-7-5-14(6-8-15)18-13-26-20(24-18)23-16-9-10-19(25-2)17(21)12-16/h5-10,12-13,22H,3-4,11H2,1-2H3,(H,23,24) |
| InChIKey | QPGUGKZBSCGUAN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|