C24H27N3OS — CID 158489870
5-[2-[(4-octoxyphenyl)methyl]-1,3-thiazol-4-yl]pyridine-2-carbonitrile (PubChem CID 158489870) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is 5-[2-[(4-octoxyphenyl)methyl]-1,3-thiazol-4-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[2-[(4-octoxyphenyl)methyl]-1,3-thiazol-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 158489870 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 5-[2-[(4-octoxyphenyl)methyl]-1,3-thiazol-4-yl]pyridine-2-carbonitrile |
| SMILES | CCCCCCCCOc1ccc(Cc2nc(-c3ccc(C#N)nc3)cs2)cc1 |
| InChI | InChI=1S/C24H27N3OS/c1-2-3-4-5-6-7-14-28-22-12-8-19(9-13-22)15-24-27-23(18-29-24)20-10-11-21(16-25)26-17-20/h8-13,17-18H,2-7,14-15H2,1H3 |
| InChIKey | HIOHXVRFJOOEJA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|