C24H25F3N4O5S — CID 160790300
5-nitro-2-[[2-nitro-4-octoxy-5-(trifluoromethyl)phenyl]methyl]-4-pyridin-3-yl-1,3-thiazole (PubChem CID 160790300) has the molecular formula C24H25F3N4O5S and a molecular weight of 538.55 g/mol. Its IUPAC name is 5-nitro-2-[[2-nitro-4-octoxy-5-(trifluoromethyl)phenyl]methyl]-4-pyridin-3-yl-1,3-thiazole.
| Compound Name | 5-nitro-2-[[2-nitro-4-octoxy-5-(trifluoromethyl)phenyl]methyl]-4-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 160790300 |
| Molecular Formula | C24H25F3N4O5S |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 5-nitro-2-[[2-nitro-4-octoxy-5-(trifluoromethyl)phenyl]methyl]-4-pyridin-3-yl-1,3-thiazole |
| SMILES | CCCCCCCCOc1cc([N+](=O)[O-])c(Cc2nc(-c3cccnc3)c([N+](=O)[O-])s2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H25F3N4O5S/c1-2-3-4-5-6-7-11-36-20-14-19(30(32)33)17(12-18(20)24(25,26)27)13-21-29-22(23(37-21)31(34)35)16-9-8-10-28-15-16/h8-10,12,14-15H,2-7,11,13H2,1H3 |
| InChIKey | ZGKLKXBAJBONGT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 121.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|