C24H27ClN2O4S2 — CID 58966347
methyl 2-(N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-4-octoxyanilino)-2-oxoacetate (PubChem CID 58966347) has the molecular formula C24H27ClN2O4S2 and a molecular weight of 507.08 g/mol. Its IUPAC name is methyl 2-(N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-4-octoxyanilino)-2-oxoacetate.
| Compound Name | methyl 2-(N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-4-octoxyanilino)-2-oxoacetate |
|---|---|
| PubChem CID | 58966347 |
| Molecular Formula | C24H27ClN2O4S2 |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | methyl 2-(N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-4-octoxyanilino)-2-oxoacetate |
| SMILES | CCCCCCCCOc1ccc(N(C(=O)C(=O)OC)c2nc(-c3ccc(Cl)s3)cs2)cc1 |
| InChI | InChI=1S/C24H27ClN2O4S2/c1-3-4-5-6-7-8-15-31-18-11-9-17(10-12-18)27(22(28)23(29)30-2)24-26-19(16-32-24)20-13-14-21(25)33-20/h9-14,16H,3-8,15H2,1-2H3 |
| InChIKey | WOBUBTJOQDBDSA-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|