C28H34N2O2S2 — CID 90784700
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(4-nonylsulfanylphenyl)prop-2-enamide (PubChem CID 90784700) has the molecular formula C28H34N2O2S2 and a molecular weight of 494.73 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(4-nonylsulfanylphenyl)prop-2-enamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(4-nonylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90784700 |
| Molecular Formula | C28H34N2O2S2 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(4-nonylsulfanylphenyl)prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(SCCCCCCCCC)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C28H34N2O2S2/c1-4-6-7-8-9-10-11-20-33-25-18-14-23(15-19-25)30(27(31)5-2)28-29-26(21-34-28)22-12-16-24(32-3)17-13-22/h5,12-19,21H,2,4,6-11,20H2,1,3H3 |
| InChIKey | YADNWGFGEBKDOE-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|