C27H24N2O2S2 — CID 91322177
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-methylphenyl)methylsulfanyl]phenyl]prop-2-enamide (PubChem CID 91322177) has the molecular formula C27H24N2O2S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-methylphenyl)methylsulfanyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-methylphenyl)methylsulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91322177 |
| Molecular Formula | C27H24N2O2S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-methylphenyl)methylsulfanyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(SCc2ccc(C)cc2)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C27H24N2O2S2/c1-4-26(30)29(27-28-25(18-33-27)21-9-13-23(31-3)14-10-21)22-11-15-24(16-12-22)32-17-20-7-5-19(2)6-8-20/h4-16,18H,1,17H2,2-3H3 |
| InChIKey | ZNMMOAWLILSWDR-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|