C27H24N2O4S2 — CID 91494865
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-methylphenyl)methylsulfonyl]phenyl]prop-2-enamide (PubChem CID 91494865) has the molecular formula C27H24N2O4S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-methylphenyl)methylsulfonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-methylphenyl)methylsulfonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91494865 |
| Molecular Formula | C27H24N2O4S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-methylphenyl)methylsulfonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(S(=O)(=O)Cc2ccc(C)cc2)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C27H24N2O4S2/c1-4-26(30)29(27-28-25(17-34-27)21-9-13-23(33-3)14-10-21)22-11-15-24(16-12-22)35(31,32)18-20-7-5-19(2)6-8-20/h4-17H,1,18H2,2-3H3 |
| InChIKey | PNCQYWQHEWTYDT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|