C21H17F3N2O3S — CID 90769980
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide (PubChem CID 90769980) has the molecular formula C21H17F3N2O3S and a molecular weight of 434.44 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90769980 |
| Molecular Formula | C21H17F3N2O3S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(OCC(F)(F)F)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C21H17F3N2O3S/c1-3-19(27)26(15-6-10-17(11-7-15)29-13-21(22,23)24)20-25-18(12-30-20)14-4-8-16(28-2)9-5-14/h3-12H,1,13H2,2H3 |
| InChIKey | WNSPDSCVGUCGHD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|