C29H28N2O4S2 — CID 90937329
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-propan-2-ylphenyl)methylsulfonyl]phenyl]prop-2-enamide (PubChem CID 90937329) has the molecular formula C29H28N2O4S2 and a molecular weight of 532.69 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-propan-2-ylphenyl)methylsulfonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-propan-2-ylphenyl)methylsulfonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90937329 |
| Molecular Formula | C29H28N2O4S2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-[4-[(4-propan-2-ylphenyl)methylsulfonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(S(=O)(=O)Cc2ccc(C(C)C)cc2)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C29H28N2O4S2/c1-5-28(32)31(29-30-27(18-36-29)23-10-14-25(35-4)15-11-23)24-12-16-26(17-13-24)37(33,34)19-21-6-8-22(9-7-21)20(2)3/h5-18,20H,1,19H2,2-4H3 |
| InChIKey | DLXPWKJBTANXAD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|