C20H18N2O4S2 — CID 90921896
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(4-methylsulfonylphenyl)prop-2-enamide (PubChem CID 90921896) has the molecular formula C20H18N2O4S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(4-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(4-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90921896 |
| Molecular Formula | C20H18N2O4S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(4-methylsulfonylphenyl)prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(S(C)(=O)=O)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C20H18N2O4S2/c1-4-19(23)22(15-7-11-17(12-8-15)28(3,24)25)20-21-18(13-27-20)14-5-9-16(26-2)10-6-14/h4-13H,1H2,2-3H3 |
| InChIKey | GHEUCRQPMHTOQO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|