C20H15F3N2O2S — CID 91568858
N-[4-(2,2-difluoroethoxy)phenyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 91568858) has the molecular formula C20H15F3N2O2S and a molecular weight of 404.41 g/mol. Its IUPAC name is N-[4-(2,2-difluoroethoxy)phenyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-(2,2-difluoroethoxy)phenyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 91568858 |
| Molecular Formula | C20H15F3N2O2S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-[4-(2,2-difluoroethoxy)phenyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(OCC(F)F)cc1)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C20H15F3N2O2S/c1-2-19(26)25(15-7-9-16(10-8-15)27-11-18(22)23)20-24-17(12-28-20)13-3-5-14(21)6-4-13/h2-10,12,18H,1,11H2 |
| InChIKey | FWVUDLVVNYBHOY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|