C28H23FN2O5S — CID 91601970
N-[4-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 91601970) has the molecular formula C28H23FN2O5S and a molecular weight of 518.57 g/mol. Its IUPAC name is N-[4-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 91601970 |
| Molecular Formula | C28H23FN2O5S |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | N-[4-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(OCc2cc(F)cc3c2OCOC3)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C28H23FN2O5S/c1-3-26(32)31(28-30-25(16-37-28)18-4-8-23(33-2)9-5-18)22-6-10-24(11-7-22)35-15-20-13-21(29)12-19-14-34-17-36-27(19)20/h3-13,16H,1,14-15,17H2,2H3 |
| InChIKey | QRCGGAJGGXUCSC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|