C26H21FN2O3S — CID 91586055
N-[4-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 91586055) has the molecular formula C26H21FN2O3S and a molecular weight of 460.53 g/mol. Its IUPAC name is N-[4-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 91586055 |
| Molecular Formula | C26H21FN2O3S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-[4-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(OCc2cccc(F)c2)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C26H21FN2O3S/c1-3-25(30)29(26-28-24(17-33-26)19-7-11-22(31-2)12-8-19)21-9-13-23(14-10-21)32-16-18-5-4-6-20(27)15-18/h3-15,17H,1,16H2,2H3 |
| InChIKey | OPTSHVLODGTJSA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|