C25H18F2N2O2S — CID 90715840
N-[4-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 90715840) has the molecular formula C25H18F2N2O2S and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[4-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90715840 |
| Molecular Formula | C25H18F2N2O2S |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[4-[(3-fluorophenyl)methoxy]phenyl]-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(OCc2cccc(F)c2)cc1)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C25H18F2N2O2S/c1-2-24(30)29(25-28-23(16-32-25)18-6-8-19(26)9-7-18)21-10-12-22(13-11-21)31-15-17-4-3-5-20(27)14-17/h2-14,16H,1,15H2 |
| InChIKey | AAMZPEOWVXZKEX-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|