C22H22N2O4S — CID 91358633
N-[4-(3-hydroxypropoxy)phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 91358633) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[4-(3-hydroxypropoxy)phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-(3-hydroxypropoxy)phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 91358633 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[4-(3-hydroxypropoxy)phenyl]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)N(c1ccc(OCCCO)cc1)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C22H22N2O4S/c1-3-21(26)24(17-7-11-19(12-8-17)28-14-4-13-25)22-23-20(15-29-22)16-5-9-18(27-2)10-6-16/h3,5-12,15,25H,1,4,13-14H2,2H3 |
| InChIKey | VXEANTROLRFFJY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|