C28H37N5O4S — CID 75081786
N'-hydroxy-4-[5-[4-[2-[methyl(2-morpholin-4-ylethyl)amino]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 75081786) has the molecular formula C28H37N5O4S and a molecular weight of 539.70 g/mol. Its IUPAC name is N'-hydroxy-4-[5-[4-[2-[methyl(2-morpholin-4-ylethyl)amino]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[5-[4-[2-[methyl(2-morpholin-4-ylethyl)amino]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 75081786 |
| Molecular Formula | C28H37N5O4S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | N'-hydroxy-4-[5-[4-[2-[methyl(2-morpholin-4-ylethyl)amino]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | CN(CCN1CCOCC1)c1nc(-c2ccc(OCCCCCOc3ccc(C(N)=NO)cc3)cc2)cs1 |
| InChI | InChI=1S/C28H37N5O4S/c1-32(13-14-33-15-19-35-20-16-33)28-30-26(21-38-28)22-5-9-24(10-6-22)36-17-3-2-4-18-37-25-11-7-23(8-12-25)27(29)31-34/h5-12,21,34H,2-4,13-20H2,1H3,(H2,29,31) |
| InChIKey | OLYOYAWINYDLKT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|