C32H46N6O4S — CID 25183157
N'-hydroxy-4-[5-[4-[2-[methyl(2-morpholin-4-ylethyl)amino]-5-[(propan-2-ylamino)methyl]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 25183157) has the molecular formula C32H46N6O4S and a molecular weight of 610.83 g/mol. Its IUPAC name is N'-hydroxy-4-[5-[4-[2-[methyl(2-morpholin-4-ylethyl)amino]-5-[(propan-2-ylamino)methyl]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[5-[4-[2-[methyl(2-morpholin-4-ylethyl)amino]-5-[(propan-2-ylamino)methyl]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 25183157 |
| Molecular Formula | C32H46N6O4S |
| Molecular Weight | 610.83 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | N'-hydroxy-4-[5-[4-[2-[methyl(2-morpholin-4-ylethyl)amino]-5-[(propan-2-ylamino)methyl]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | CC(C)NCc1sc(N(C)CCN2CCOCC2)nc1-c1ccc(OCCCCCOc2ccc(/C(N)=N\O)cc2)cc1 |
| InChI | InChI=1S/C32H46N6O4S/c1-24(2)34-23-29-30(35-32(43-29)37(3)15-16-38-17-21-40-22-18-38)25-7-11-27(12-8-25)41-19-5-4-6-20-42-28-13-9-26(10-14-28)31(33)36-39/h7-14,24,34,39H,4-6,15-23H2,1-3H3,(H2,33,36) |
| InChIKey | TVXFTWVSNCYEBN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|