C30H34N4O3S — CID 46852308
4-[5-[4-[2-[benzyl(methyl)amino]-5-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 46852308) has the molecular formula C30H34N4O3S and a molecular weight of 530.69 g/mol. Its IUPAC name is 4-[5-[4-[2-[benzyl(methyl)amino]-5-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[2-[benzyl(methyl)amino]-5-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 46852308 |
| Molecular Formula | C30H34N4O3S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 4-[5-[4-[2-[benzyl(methyl)amino]-5-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1sc(N(C)Cc2ccccc2)nc1-c1ccc(OCCCCCOc2ccc(/C(N)=N\O)cc2)cc1 |
| InChI | InChI=1S/C30H34N4O3S/c1-22-28(32-30(38-22)34(2)21-23-9-5-3-6-10-23)24-11-15-26(16-12-24)36-19-7-4-8-20-37-27-17-13-25(14-18-27)29(31)33-35/h3,5-6,9-18,35H,4,7-8,19-21H2,1-2H3,(H2,31,33) |
| InChIKey | DLGFJUNVGJKMBU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|