C29H32N4O3S — CID 87149115
4-[5-[4-[5-benzyl-2-(methylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 87149115) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is 4-[5-[4-[5-benzyl-2-(methylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[5-benzyl-2-(methylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 87149115 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 4-[5-[4-[5-benzyl-2-(methylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | CNc1nc(-c2ccc(OCCCCCOc3ccc(/C(N)=N/O)cc3)cc2)c(Cc2ccccc2)s1 |
| InChI | InChI=1S/C29H32N4O3S/c1-31-29-32-27(26(37-29)20-21-8-4-2-5-9-21)22-10-14-24(15-11-22)35-18-6-3-7-19-36-25-16-12-23(13-17-25)28(30)33-34/h2,4-5,8-17,34H,3,6-7,18-20H2,1H3,(H2,30,33)(H,31,32) |
| InChIKey | SHLAUJWNQVDNFV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|