C25H32N4O5S2 — CID 72987146
4-[5-[4-[5-ethyl-2-(ethylsulfonylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 72987146) has the molecular formula C25H32N4O5S2 and a molecular weight of 532.69 g/mol. Its IUPAC name is 4-[5-[4-[5-ethyl-2-(ethylsulfonylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[5-ethyl-2-(ethylsulfonylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 72987146 |
| Molecular Formula | C25H32N4O5S2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 4-[5-[4-[5-ethyl-2-(ethylsulfonylamino)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCc1sc(NS(=O)(=O)CC)nc1-c1ccc(OCCCCCOc2ccc(C(N)=NO)cc2)cc1 |
| InChI | InChI=1S/C25H32N4O5S2/c1-3-22-23(27-25(35-22)29-36(31,32)4-2)18-8-12-20(13-9-18)33-16-6-5-7-17-34-21-14-10-19(11-15-21)24(26)28-30/h8-15,30H,3-7,16-17H2,1-2H3,(H2,26,28)(H,27,29) |
| InChIKey | XXTRWKMWXYXKTL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 136.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|