C29H43N3O9S3 — CID 25104254
ethanesulfonic acid;N'-hydroxy-4-[5-[4-(2-methyl-5-propan-2-yl-1,3-thiazol-4-yl)phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 25104254) has the molecular formula C29H43N3O9S3 and a molecular weight of 673.88 g/mol. Its IUPAC name is ethanesulfonic acid;N'-hydroxy-4-[5-[4-(2-methyl-5-propan-2-yl-1,3-thiazol-4-yl)phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | ethanesulfonic acid;N'-hydroxy-4-[5-[4-(2-methyl-5-propan-2-yl-1,3-thiazol-4-yl)phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 25104254 |
| Molecular Formula | C29H43N3O9S3 |
| Molecular Weight | 673.88 g/mol |
| Exact Mass | 673.22 |
| IUPAC Name | ethanesulfonic acid;N'-hydroxy-4-[5-[4-(2-methyl-5-propan-2-yl-1,3-thiazol-4-yl)phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | CCS(=O)(=O)O.CCS(=O)(=O)O.Cc1nc(-c2ccc(OCCCCCOc3ccc(/C(N)=N/O)cc3)cc2)c(C(C)C)s1 |
| InChI | InChI=1S/C25H31N3O3S.2C2H6O3S/c1-17(2)24-23(27-18(3)32-24)19-7-11-21(12-8-19)30-15-5-4-6-16-31-22-13-9-20(10-14-22)25(26)28-29;2*1-2-6(3,4)5/h7-14,17,29H,4-6,15-16H2,1-3H3,(H2,26,28);2*2H2,1H3,(H,3,4,5) |
| InChIKey | IPVZVOFXZUWMCN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 198.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|