C30H40N4O4S — CID 123954086
4-[5-[4-[5-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-2-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 123954086) has the molecular formula C30H40N4O4S and a molecular weight of 552.74 g/mol. Its IUPAC name is 4-[5-[4-[5-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-2-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[5-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-2-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 123954086 |
| Molecular Formula | C30H40N4O4S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 4-[5-[4-[5-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-2-methyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1nc(-c2ccc(OCCCCCOc3ccc(C(N)=NO)cc3)cc2)c(CCN2CC(C)OC(C)C2)s1 |
| InChI | InChI=1S/C30H40N4O4S/c1-21-19-34(20-22(2)38-21)16-15-28-29(32-23(3)39-28)24-7-11-26(12-8-24)36-17-5-4-6-18-37-27-13-9-25(10-14-27)30(31)33-35/h7-14,21-22,35H,4-6,15-20H2,1-3H3,(H2,31,33) |
| InChIKey | XXQXKQMKNXRDNM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|