C28H36N4O4S — CID 16678120
N'-hydroxy-4-[5-[4-[2-methyl-5-(2-morpholin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 16678120) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is N'-hydroxy-4-[5-[4-[2-methyl-5-(2-morpholin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[5-[4-[2-methyl-5-(2-morpholin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 16678120 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | N'-hydroxy-4-[5-[4-[2-methyl-5-(2-morpholin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | Cc1nc(-c2ccc(OCCCCCOc3ccc(/C(N)=N\O)cc3)cc2)c(CCN2CCOCC2)s1 |
| InChI | InChI=1S/C28H36N4O4S/c1-21-30-27(26(37-21)13-14-32-15-19-34-20-16-32)22-5-9-24(10-6-22)35-17-3-2-4-18-36-25-11-7-23(8-12-25)28(29)31-33/h5-12,33H,2-4,13-20H2,1H3,(H2,29,31) |
| InChIKey | QIFAUOOJYOYSQM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|