C27H35N5O4S — CID 149151741
4-[5-[4-[2-amino-5-(2-morpholin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 149151741) has the molecular formula C27H35N5O4S and a molecular weight of 525.68 g/mol. Its IUPAC name is 4-[5-[4-[2-amino-5-(2-morpholin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[2-amino-5-(2-morpholin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 149151741 |
| Molecular Formula | C27H35N5O4S |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 4-[5-[4-[2-amino-5-(2-morpholin-4-ylethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(OCCCCCOc2ccc(-c3nc(N)sc3CCN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C27H35N5O4S/c28-26(31-33)21-6-10-23(11-7-21)36-17-3-1-2-16-35-22-8-4-20(5-9-22)25-24(37-27(29)30-25)12-13-32-14-18-34-19-15-32/h4-11,33H,1-3,12-19H2,(H2,28,31)(H2,29,30) |
| InChIKey | BIXKUDCKWCNHFU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|