C29H39N5O4S — CID 25183295
4-[5-[4-[2-[ethyl(methyl)amino]-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 25183295) has the molecular formula C29H39N5O4S and a molecular weight of 553.73 g/mol. Its IUPAC name is 4-[5-[4-[2-[ethyl(methyl)amino]-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[2-[ethyl(methyl)amino]-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 25183295 |
| Molecular Formula | C29H39N5O4S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 4-[5-[4-[2-[ethyl(methyl)amino]-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCN(C)c1nc(-c2ccc(OCCCCCOc3ccc(/C(N)=N\O)cc3)cc2)c(CN2CCOCC2)s1 |
| InChI | InChI=1S/C29H39N5O4S/c1-3-33(2)29-31-27(26(39-29)21-34-15-19-36-20-16-34)22-7-11-24(12-8-22)37-17-5-4-6-18-38-25-13-9-23(10-14-25)28(30)32-35/h7-14,35H,3-6,15-21H2,1-2H3,(H2,30,32) |
| InChIKey | MUZHTCIQVUFFCF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|