C30H42N6O4S — CID 24760567
N'-hydroxy-4-[5-[4-[2-(methylamino)-5-[2-(2-morpholin-4-ylethylamino)ethyl]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide (PubChem CID 24760567) has the molecular formula C30H42N6O4S and a molecular weight of 582.77 g/mol. Its IUPAC name is N'-hydroxy-4-[5-[4-[2-(methylamino)-5-[2-(2-morpholin-4-ylethylamino)ethyl]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[5-[4-[2-(methylamino)-5-[2-(2-morpholin-4-ylethylamino)ethyl]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 24760567 |
| Molecular Formula | C30H42N6O4S |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | N'-hydroxy-4-[5-[4-[2-(methylamino)-5-[2-(2-morpholin-4-ylethylamino)ethyl]-1,3-thiazol-4-yl]phenoxy]pentoxy]benzenecarboximidamide |
| SMILES | CNc1nc(-c2ccc(OCCCCCOc3ccc(/C(N)=N/O)cc3)cc2)c(CCNCCN2CCOCC2)s1 |
| InChI | InChI=1S/C30H42N6O4S/c1-32-30-34-28(27(41-30)13-14-33-15-16-36-17-21-38-22-18-36)23-5-9-25(10-6-23)39-19-3-2-4-20-40-26-11-7-24(8-12-26)29(31)35-37/h5-12,33,37H,2-4,13-22H2,1H3,(H2,31,35)(H,32,34) |
| InChIKey | KRWIPUDRAWCSSL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|