C27H32N4O3S — CID 87439523
4-[5-[4-[2-(methylamino)-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzonitrile (PubChem CID 87439523) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is 4-[5-[4-[2-(methylamino)-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzonitrile.
| Compound Name | 4-[5-[4-[2-(methylamino)-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzonitrile |
|---|---|
| PubChem CID | 87439523 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 4-[5-[4-[2-(methylamino)-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]benzonitrile |
| SMILES | CNc1nc(-c2ccc(OCCCCCOc3ccc(C#N)cc3)cc2)c(CN2CCOCC2)s1 |
| InChI | InChI=1S/C27H32N4O3S/c1-29-27-30-26(25(35-27)20-31-13-17-32-18-14-31)22-7-11-24(12-8-22)34-16-4-2-3-15-33-23-9-5-21(19-28)6-10-23/h5-12H,2-4,13-18,20H2,1H3,(H,29,30) |
| InChIKey | GTEDQQJKARQHOV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 79.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|