C34H41N5O4S — CID 25147505
4-[5-[4-[2-[benzyl(methyl)amino]-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 25147505) has the molecular formula C34H41N5O4S and a molecular weight of 615.80 g/mol. Its IUPAC name is 4-[5-[4-[2-[benzyl(methyl)amino]-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[2-[benzyl(methyl)amino]-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 25147505 |
| Molecular Formula | C34H41N5O4S |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | 4-[5-[4-[2-[benzyl(methyl)amino]-5-(morpholin-4-ylmethyl)-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | CN(Cc1ccccc1)c1nc(-c2ccc(OCCCCCOc3ccc(/C(N)=N/O)cc3)cc2)c(CN2CCOCC2)s1 |
| InChI | InChI=1S/C34H41N5O4S/c1-38(24-26-8-4-2-5-9-26)34-36-32(31(44-34)25-39-18-22-41-23-19-39)27-10-14-29(15-11-27)42-20-6-3-7-21-43-30-16-12-28(13-17-30)33(35)37-40/h2,4-5,8-17,40H,3,6-7,18-25H2,1H3,(H2,35,37) |
| InChIKey | LIHGACDQURAZKT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|