C31H40N4O4S — CID 11671333
4-[5-[4-[5-(cyclopentylmethyl)-2-morpholin-4-yl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 11671333) has the molecular formula C31H40N4O4S and a molecular weight of 564.75 g/mol. Its IUPAC name is 4-[5-[4-[5-(cyclopentylmethyl)-2-morpholin-4-yl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[5-(cyclopentylmethyl)-2-morpholin-4-yl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 11671333 |
| Molecular Formula | C31H40N4O4S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 4-[5-[4-[5-(cyclopentylmethyl)-2-morpholin-4-yl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(OCCCCCOc2ccc(-c3nc(N4CCOCC4)sc3CC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H40N4O4S/c32-30(34-36)25-10-14-27(15-11-25)39-19-5-1-4-18-38-26-12-8-24(9-13-26)29-28(22-23-6-2-3-7-23)40-31(33-29)35-16-20-37-21-17-35/h8-15,23,36H,1-7,16-22H2,(H2,32,34) |
| InChIKey | ZUSLMRTVHCTKAV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|