C33H37N3O3S — CID 75058890
4-[5-[4-[5-(cyclopentylmethyl)-2-phenyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 75058890) has the molecular formula C33H37N3O3S and a molecular weight of 555.74 g/mol. Its IUPAC name is 4-[5-[4-[5-(cyclopentylmethyl)-2-phenyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[5-[4-[5-(cyclopentylmethyl)-2-phenyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 75058890 |
| Molecular Formula | C33H37N3O3S |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 4-[5-[4-[5-(cyclopentylmethyl)-2-phenyl-1,3-thiazol-4-yl]phenoxy]pentoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(OCCCCCOc2ccc(-c3nc(-c4ccccc4)sc3CC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C33H37N3O3S/c34-32(36-37)26-15-19-29(20-16-26)39-22-8-2-7-21-38-28-17-13-25(14-18-28)31-30(23-24-9-5-6-10-24)40-33(35-31)27-11-3-1-4-12-27/h1,3-4,11-20,24,37H,2,5-10,21-23H2,(H2,34,36) |
| InChIKey | XGEDPPPMCLEXEI-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|