C33H31N5O4S — CID 74401085
N-[4-[4-[5-[4-(N'-hydroxycarbamimidoyl)phenoxy]pentoxy]phenyl]-2-phenyl-1,3-thiazol-5-yl]pyridine-3-carboxamide (PubChem CID 74401085) has the molecular formula C33H31N5O4S and a molecular weight of 593.71 g/mol. Its IUPAC name is N-[4-[4-[5-[4-(N'-hydroxycarbamimidoyl)phenoxy]pentoxy]phenyl]-2-phenyl-1,3-thiazol-5-yl]pyridine-3-carboxamide.
| Compound Name | N-[4-[4-[5-[4-(N'-hydroxycarbamimidoyl)phenoxy]pentoxy]phenyl]-2-phenyl-1,3-thiazol-5-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 74401085 |
| Molecular Formula | C33H31N5O4S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-[4-[4-[5-[4-(N'-hydroxycarbamimidoyl)phenoxy]pentoxy]phenyl]-2-phenyl-1,3-thiazol-5-yl]pyridine-3-carboxamide |
| SMILES | NC(=NO)c1ccc(OCCCCCOc2ccc(-c3nc(-c4ccccc4)sc3NC(=O)c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C33H31N5O4S/c34-30(38-40)24-13-17-28(18-14-24)42-21-6-2-5-20-41-27-15-11-23(12-16-27)29-33(37-31(39)26-10-7-19-35-22-26)43-32(36-29)25-8-3-1-4-9-25/h1,3-4,7-19,22,40H,2,5-6,20-21H2,(H2,34,38)(H,37,39) |
| InChIKey | AEOAUVPSGQLZKA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 131.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|